CAS 27460-85-1 appears in our catalog under these names: N-tert-Butoxycarbonyl-D-(4-hydroxyphenyl)glycine, 98%, 98%, (R)-2-((tert-Butoxycarbonyl)amino)-2-(4-hydroxyphenyl)acetic acid, 97%, Boc-D-Phg(4-OH)-OH, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
(2R)-2-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 27460-85-1) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: (2R)-2-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: LRWJRIFKJPPAPM-SNVBAGLBSA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | (2R)-2-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | LRWJRIFKJPPAPM-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)