CAS 69651-48-5 appears in our catalog under these names: N-Boc-4-hydroxyphenyl-l-glycine, 95%, (S)–2–((tert–Butoxycarbonyl)amino)–2–(4–hydroxyphenyl)acetic acid, (S)-2-((tert-Butoxycarbonyl)amino)-2-(4-hydroxyphenyl)acetic acid, 97%, 97%, (2S)-[(TERT-BUTOXYCARBONYL)AMINO](4-HYDROXYPHENYL)ETHANOIC ACID, 96%, Boc-4-OH-Phg-OH, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 250mg, 25g, 1g, 5g, 100mg.
(2S)-2-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 69651-48-5) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: (2S)-2-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: LRWJRIFKJPPAPM-JTQLQIEISA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | (2S)-2-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | LRWJRIFKJPPAPM-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)