Products 2747917-68-4
CAS 2747917-68-4 appears in our catalog under these names: (±)-MDA-d3 Hydrochloride, (±)–MDA–d3 (hydrochloride) (exempt preparation). Offered by: TRC, GLPBio. Available pack sizes: 25mg, 1mg.
3-(1,3-benzodioxol-5-yl)-1,1,1-trideuteriopropan-2-amine;hydrochloride (CAS 2747917-68-4) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 218.69 g/mol. IUPAC name: 3-(1,3-benzodioxol-5-yl)-1,1,1-trideuteriopropan-2-amine;hydrochloride. InChIKey: XLAOKZDOZHZWBK-NIIDSAIPSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 218.69 g/mol |
| IUPAC name | 3-(1,3-benzodioxol-5-yl)-1,1,1-trideuteriopropan-2-amine;hydrochloride |
| InChIKey | XLAOKZDOZHZWBK-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])C(CC1=CC2=C(C=C1)OCO2)N.Cl |
Computed by PubChem (NCBI)