CAS 2752-35-4 appears in our catalog under these names: 2–(2–Phenylacetamido)pentanedioic acid, PhenylAc-DL-Glu-OH 97%, 2-(2-Phenylacetamido)pentanedioic acid, 97%, 97%, 2-(2-Phenylacetamido)pentanedioic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
2-[(2-phenylacetyl)amino]pentanedioic acid (CAS 2752-35-4) is a chemical compound with the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. IUPAC name: 2-[(2-phenylacetyl)amino]pentanedioic acid. InChIKey: PTSRBZOZSRJCKX-UHFFFAOYSA-N.
| Molecular formula | C13H15NO5 |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | 2-[(2-phenylacetyl)amino]pentanedioic acid |
| InChIKey | PTSRBZOZSRJCKX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)NC(CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)