Products 27565-37-3
CAS 27565-37-3 is the registry number for (E)-2-Styryl-4,5-dihydrothiazole, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-[(E)-2-phenylethenyl]-4,5-dihydro-1,3-thiazole (CAS 27565-37-3) is a chemical compound with the molecular formula C11H11NS and a molecular weight of 189.28 g/mol. IUPAC name: 2-[(E)-2-phenylethenyl]-4,5-dihydro-1,3-thiazole. InChIKey: BHXRULBFMDQOMX-VOTSOKGWSA-N.
| Molecular formula | C11H11NS |
|---|---|
| Molecular weight | 189.28 g/mol |
| IUPAC name | 2-[(E)-2-phenylethenyl]-4,5-dihydro-1,3-thiazole |
| InChIKey | BHXRULBFMDQOMX-VOTSOKGWSA-N |
| SMILES | C1CSC(=N1)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)