Products 27566-09-2
CAS 27566-09-2 is the registry number for Salbutamol Impurity 49. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxybenzoate (CAS 27566-09-2) is a chemical compound with the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. IUPAC name: methyl 5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxybenzoate. InChIKey: HWLMCRZJMPDSRW-UHFFFAOYSA-N.
| Molecular formula | C14H21NO4 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | methyl 5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxybenzoate |
| InChIKey | HWLMCRZJMPDSRW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(C1=CC(=C(C=C1)O)C(=O)OC)O |
Computed by PubChem (NCBI)