Products 2757085-37-1
CAS 2757085-37-1 appears in our catalog under these names: (4R,5S)-4,5-Diphenyl-2-(pyridin-2-ylmethyl)-4,5-dihydrooxazole, 97%, 97%, (4R,5S)-4,5-Diphenyl-2-(pyridin-2-ylmethyl)-4,5-dihydrooxazole, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4R,5S)-4,5-diphenyl-2-(pyridin-2-ylmethyl)-4,5-dihydro-1,3-oxazole (CAS 2757085-37-1) is a chemical compound with the molecular formula C21H18N2O and a molecular weight of 314.4 g/mol. IUPAC name: (4R,5S)-4,5-diphenyl-2-(pyridin-2-ylmethyl)-4,5-dihydro-1,3-oxazole. InChIKey: KYXTZWSEJBGNQK-RTWAWAEBSA-N.
| Molecular formula | C21H18N2O |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | (4R,5S)-4,5-diphenyl-2-(pyridin-2-ylmethyl)-4,5-dihydro-1,3-oxazole |
| InChIKey | KYXTZWSEJBGNQK-RTWAWAEBSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H]2[C@@H](OC(=N2)CC3=CC=CC=N3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)