Products 1256584-82-3
CAS 1256584-82-3 is the registry number for 9-Ethyl-6,6-dimethyl-11-oxo-6,11-dihydro-5H-benzo[b]carbazole-3-carbonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
9-ethyl-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile (CAS 1256584-82-3) is a chemical compound with the molecular formula C21H18N2O and a molecular weight of 314.4 g/mol. IUPAC name: 9-ethyl-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile. InChIKey: SIMAULNZUUJKDX-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 9-ethyl-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile |
| InChIKey | SIMAULNZUUJKDX-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)C(C3=C(C2=O)C4=C(N3)C=C(C=C4)C#N)(C)C |
Computed by PubChem (NCBI)