CAS 1217782-43-8 appears in our catalog under these names: (R)-N-(1-(Naphthalen-1-yl)ethyl)-1H-indole-2-carboxamide-13C, 98%, Calindol Amide-13C. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5mg, 25mg.
N-[(1R)-1-naphthalen-1-ylethyl]-1H-indole-2-carboxamide (CAS 1217782-43-8) is a chemical compound with the molecular formula C21H18N2O and a molecular weight of 315.4 g/mol. IUPAC name: N-[(1R)-1-naphthalen-1-ylethyl]-1H-indole-2-carboxamide. InChIKey: XLXUKYDIQFPOCY-QGZKNNNSSA-N.
| Molecular formula | C21H18N2O |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | N-[(1R)-1-naphthalen-1-ylethyl]-1H-indole-2-carboxamide |
| InChIKey | XLXUKYDIQFPOCY-QGZKNNNSSA-N |
| SMILES | C[C@H](C1=CC=CC2=CC=CC=C21)N[13C](=O)C3=CC4=CC=CC=C4N3 |
Computed by PubChem (NCBI)