CAS 1996626-48-2 is the registry number for 1,5-Dibenzyl-1H-indazol-3-ol. Offered by: TRC. Available pack sizes: 100mg, 10mg, 25mg.
1,5-dibenzyl-2H-indazol-3-one (CAS 1996626-48-2) is a chemical compound with the molecular formula C21H18N2O and a molecular weight of 314.4 g/mol. IUPAC name: 1,5-dibenzyl-2H-indazol-3-one. InChIKey: ITZRTCZAHXIQDZ-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 1,5-dibenzyl-2H-indazol-3-one |
| InChIKey | ITZRTCZAHXIQDZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC3=C(C=C2)N(NC3=O)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)