Products 1217724-96-3
CAS 1217724-96-3 is the registry number for ent-Calindol Amide-13C. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
N-[(1S)-1-naphthalen-1-ylethyl]-1H-indole-2-carboxamide (CAS 1217724-96-3) is a chemical compound with the molecular formula C21H18N2O and a molecular weight of 315.4 g/mol. IUPAC name: N-[(1S)-1-naphthalen-1-ylethyl]-1H-indole-2-carboxamide. InChIKey: XLXUKYDIQFPOCY-ORRZGNCYSA-N.
| Molecular formula | C21H18N2O |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | N-[(1S)-1-naphthalen-1-ylethyl]-1H-indole-2-carboxamide |
| InChIKey | XLXUKYDIQFPOCY-ORRZGNCYSA-N |
| SMILES | C[C@@H](C1=CC=CC2=CC=CC=C21)N[13C](=O)C3=CC4=CC=CC=C4N3 |
Computed by PubChem (NCBI)