CAS 163655-37-6 appears in our catalog under these names: Maz51, 95%, MAZ51, MAZ51/ 98.53% (existing batch purity), MAZ51 98%, VEGFR3 Kinase Inhibitor, MAZ 1PC X 10MG. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 1mg, 2mg, 5mg, 10mg, 25mg.
3-[[4-(dimethylamino)naphthalen-1-yl]methylidene]-1H-indol-2-one (CAS 163655-37-6) is a chemical compound with the molecular formula C21H18N2O and a molecular weight of 314.4 g/mol. IUPAC name: 3-[[4-(dimethylamino)naphthalen-1-yl]methylidene]-1H-indol-2-one. InChIKey: VFCXONOPGCDDBQ-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 3-[[4-(dimethylamino)naphthalen-1-yl]methylidene]-1H-indol-2-one |
| InChIKey | VFCXONOPGCDDBQ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C2=CC=CC=C21)C=C3C4=CC=CC=C4NC3=O |
Computed by PubChem (NCBI)