Products 2758092-33-8
CAS 2758092-33-8 is the registry number for 2-Chloro-5-(1-chloroethyl)-3-methoxy-4-methylpyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-5-(1-chloroethyl)-3-methoxy-4-methylpyridine (CAS 2758092-33-8) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: 2-chloro-5-(1-chloroethyl)-3-methoxy-4-methylpyridine. InChIKey: GCLLVOKUWLKEAA-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | 2-chloro-5-(1-chloroethyl)-3-methoxy-4-methylpyridine |
| InChIKey | GCLLVOKUWLKEAA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1C(C)Cl)Cl)OC |
Computed by PubChem (NCBI)