Products 2760614-38-6
CAS 2760614-38-6 is the registry number for 2,7-Dimethoxynaphthalene-1,3,4,5,6,8-d6, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1,2,4,5,7,8-hexadeuterio-3,6-dimethoxynaphthalene (CAS 2760614-38-6) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 194.26 g/mol. IUPAC name: 1,2,4,5,7,8-hexadeuterio-3,6-dimethoxynaphthalene. InChIKey: PPKHAIRFQKFMLE-HBFHXPTCSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | 1,2,4,5,7,8-hexadeuterio-3,6-dimethoxynaphthalene |
| InChIKey | PPKHAIRFQKFMLE-HBFHXPTCSA-N |
| SMILES | [2H]C1=C(C(=C(C2=C1C(=C(C(=C2[2H])OC)[2H])[2H])[2H])OC)[2H] |
Computed by PubChem (NCBI)