CAS 3469-26-9 appears in our catalog under these names: 2,7–Dimethoxynaphthalene, 2,7-Dimethoxynaphthalene, 2,7-Dimethoxynaphthalene, >98.0%(GC), 2,7-Dimethoxynaphthalene 97%, 2,7-DIMETHOXYNAPHTHALENE, 98%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 25g, 500g, 0,1kg, 0,05kg, 0,25kg, 0,5kg, 1kg.
2,7-dimethoxynaphthalene (CAS 3469-26-9) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: 2,7-dimethoxynaphthalene. InChIKey: PPKHAIRFQKFMLE-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 2,7-dimethoxynaphthalene |
| InChIKey | PPKHAIRFQKFMLE-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=CC(=C2)OC |
Computed by PubChem (NCBI)