CAS 2762670-79-9 is the registry number for 1-(3,5-dichlorophenyl)cyclobutanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3,5-dichlorophenyl)cyclobutan-1-ol (CAS 2762670-79-9) is a chemical compound with the molecular formula C10H10Cl2O and a molecular weight of 217.09 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)cyclobutan-1-ol. InChIKey: YCNAPIBPQPNIMT-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)cyclobutan-1-ol |
| InChIKey | YCNAPIBPQPNIMT-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC(=CC(=C2)Cl)Cl)O |
Computed by PubChem (NCBI)