Products 2763385-81-3
CAS 2763385-81-3 is the registry number for 2-Methoxy-6-vinylphenylboronic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2-ethenyl-6-methoxyphenyl)boronic acid (CAS 2763385-81-3) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: (2-ethenyl-6-methoxyphenyl)boronic acid. InChIKey: IHNLSOGRBYGFGI-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | (2-ethenyl-6-methoxyphenyl)boronic acid |
| InChIKey | IHNLSOGRBYGFGI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1OC)C=C)(O)O |
Computed by PubChem (NCBI)