CAS 2763646-78-0 is the registry number for Methyl (R)-3-(2-oxooxazolidin-4-yl)propanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-[(4R)-2-oxo-1,3-oxazolidin-4-yl]propanoate (CAS 2763646-78-0) is a chemical compound with the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. IUPAC name: methyl 3-[(4R)-2-oxo-1,3-oxazolidin-4-yl]propanoate. InChIKey: BCXRVLRZEXVMGD-RXMQYKEDSA-N.
| Molecular formula | C7H11NO4 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | methyl 3-[(4R)-2-oxo-1,3-oxazolidin-4-yl]propanoate |
| InChIKey | BCXRVLRZEXVMGD-RXMQYKEDSA-N |
| SMILES | COC(=O)CC[C@@H]1COC(=O)N1 |
Computed by PubChem (NCBI)