Products 2766053-10-3

CAS 2766053-10-3 is the registry number for 1-(tert-Butyl) 4-ethyl 2-methyl-5-oxopiperidine-1,4-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-O-tert-butyl 4-O-ethyl 2-methyl-5-oxopiperidine-1,4-dicarboxylate (CAS 2766053-10-3) is a chemical compound with the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl 2-methyl-5-oxopiperidine-1,4-dicarboxylate. InChIKey: MGQLUJUFVVDLQA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H23NO5
Molecular weight285.34 g/mol
IUPAC name1-O-tert-butyl 4-O-ethyl 2-methyl-5-oxopiperidine-1,4-dicarboxylate
InChIKeyMGQLUJUFVVDLQA-UHFFFAOYSA-N
SMILESCCOC(=O)C1CC(N(CC1=O)C(=O)OC(C)(C)C)C

Computed by PubChem (NCBI)