CAS 2768212-81-1 appears in our catalog under these names: 1-(tert-Butyl) 4-ethyl (2R)-2-methyl-5-oxopiperidine-1,4-dicarboxylate, 98%, 1-(1,1-Dimethylethyl) 4-ethyl (2R)-2-methyl-5-oxo-1,4-piperidinedicarboxylate, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
1-O-tert-butyl 4-O-ethyl (2R)-2-methyl-5-oxopiperidine-1,4-dicarboxylate (CAS 2768212-81-1) is a chemical compound with the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl (2R)-2-methyl-5-oxopiperidine-1,4-dicarboxylate. InChIKey: MGQLUJUFVVDLQA-YHMJZVADSA-N.
| Molecular formula | C14H23NO5 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl (2R)-2-methyl-5-oxopiperidine-1,4-dicarboxylate |
| InChIKey | MGQLUJUFVVDLQA-YHMJZVADSA-N |
| SMILES | CCOC(=O)C1C[C@H](N(CC1=O)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)