CAS 2769128-24-5 is the registry number for 6-Chlorochromane-5-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-3,4-dihydro-2H-chromene-5-carbaldehyde (CAS 2769128-24-5) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: 6-chloro-3,4-dihydro-2H-chromene-5-carbaldehyde. InChIKey: AEFKLTRBHDJLIK-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 6-chloro-3,4-dihydro-2H-chromene-5-carbaldehyde |
| InChIKey | AEFKLTRBHDJLIK-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2C=O)Cl)OC1 |
Computed by PubChem (NCBI)