CAS 2770348-64-4 is the registry number for Ethyl (1R,2R)-2-(3-cyanopyrazin-2-yl)cyclopropane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-ethyl (1R,2R)-2-(3-cyanopyrazin-2-yl)cyclopropane-1-carboxylate (CAS 2770348-64-4) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: trans-ethyl (1R,2R)-2-(3-cyanopyrazin-2-yl)cyclopropane-1-carboxylate. InChIKey: IWGGITHSHUDXOG-HTQZYQBOSA-N.
| Molecular formula | C11H11N3O2 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | trans-ethyl (1R,2R)-2-(3-cyanopyrazin-2-yl)cyclopropane-1-carboxylate |
| InChIKey | IWGGITHSHUDXOG-HTQZYQBOSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@H]1C2=NC=CN=C2C#N |
Computed by PubChem (NCBI)