CAS 2771011-11-9 is the registry number for 7-Bromo-2-methoxy-1,5-naphthyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-2-methoxy-1,5-naphthyridine (CAS 2771011-11-9) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 7-bromo-2-methoxy-1,5-naphthyridine. InChIKey: GKCPCGYDLBFIPV-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 7-bromo-2-methoxy-1,5-naphthyridine |
| InChIKey | GKCPCGYDLBFIPV-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)N=CC(=C2)Br |
Computed by PubChem (NCBI)