CAS 2771022-79-6 is the registry number for 6'-(Trifluoromethyl)-2',3'-dihydro-1'H-spiro[cyclopropane-1,4'-isoquinolin]-1'-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(trifluoromethyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one (CAS 2771022-79-6) is a chemical compound with the molecular formula C12H10F3NO and a molecular weight of 241.21 g/mol. IUPAC name: 6-(trifluoromethyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one. InChIKey: UTXONMPKXUZMQR-UHFFFAOYSA-N.
| Molecular formula | C12H10F3NO |
|---|---|
| Molecular weight | 241.21 g/mol |
| IUPAC name | 6-(trifluoromethyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one |
| InChIKey | UTXONMPKXUZMQR-UHFFFAOYSA-N |
| SMILES | C1CC12CNC(=O)C3=C2C=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)