Products 317-68-0

CAS 317-68-0 is the registry number for 1-(1,2-Dimethyl-1H-indol-3-yl)-2,2,2-trifluoroethan-1-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-(1,2-dimethylindol-3-yl)-2,2,2-trifluoroethanone (CAS 317-68-0) is a chemical compound with the molecular formula C12H10F3NO and a molecular weight of 241.21 g/mol. IUPAC name: 1-(1,2-dimethylindol-3-yl)-2,2,2-trifluoroethanone. InChIKey: XLVXNCMKXOXMFN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10F3NO
Molecular weight241.21 g/mol
IUPAC name1-(1,2-dimethylindol-3-yl)-2,2,2-trifluoroethanone
InChIKeyXLVXNCMKXOXMFN-UHFFFAOYSA-N
SMILESCC1=C(C2=CC=CC=C2N1C)C(=O)C(F)(F)F

Computed by PubChem (NCBI)