Products 1893392-77-2
CAS 1893392-77-2 is the registry number for 2,2-Dimethyl-3-oxo-3-(4-(trifluoromethyl)phenyl)propanenitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dimethyl-3-oxo-3-[4-(trifluoromethyl)phenyl]propanenitrile (CAS 1893392-77-2) is a chemical compound with the molecular formula C12H10F3NO and a molecular weight of 241.21 g/mol. IUPAC name: 2,2-dimethyl-3-oxo-3-[4-(trifluoromethyl)phenyl]propanenitrile. InChIKey: CRNBSVOAKHBRAW-UHFFFAOYSA-N.
| Molecular formula | C12H10F3NO |
|---|---|
| Molecular weight | 241.21 g/mol |
| IUPAC name | 2,2-dimethyl-3-oxo-3-[4-(trifluoromethyl)phenyl]propanenitrile |
| InChIKey | CRNBSVOAKHBRAW-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C(=O)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)