CAS 428842-30-2 is the registry number for (3E)-4-(2,3-Dihydro-1h-indol-1-yl)-1,1,1-trifluorobut-3-en-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(E)-4-(2,3-dihydroindol-1-yl)-1,1,1-trifluorobut-3-en-2-one (CAS 428842-30-2) is a chemical compound with the molecular formula C12H10F3NO and a molecular weight of 241.21 g/mol. IUPAC name: (E)-4-(2,3-dihydroindol-1-yl)-1,1,1-trifluorobut-3-en-2-one. InChIKey: YQUWDTZFUWILAX-SOFGYWHQSA-N.
| Molecular formula | C12H10F3NO |
|---|---|
| Molecular weight | 241.21 g/mol |
| IUPAC name | (E)-4-(2,3-dihydroindol-1-yl)-1,1,1-trifluorobut-3-en-2-one |
| InChIKey | YQUWDTZFUWILAX-SOFGYWHQSA-N |
| SMILES | C1CN(C2=CC=CC=C21)/C=C/C(=O)C(F)(F)F |
Computed by PubChem (NCBI)