CAS 799265-09-1 is the registry number for 1-(7-Ethyl-1H-indol-3-yl)-2,2,2-trifluoroethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(7-ethyl-1H-indol-3-yl)-2,2,2-trifluoroethanone (CAS 799265-09-1) is a chemical compound with the molecular formula C12H10F3NO and a molecular weight of 241.21 g/mol. IUPAC name: 1-(7-ethyl-1H-indol-3-yl)-2,2,2-trifluoroethanone. InChIKey: CFHSXKZWXJYSSI-UHFFFAOYSA-N.
| Molecular formula | C12H10F3NO |
|---|---|
| Molecular weight | 241.21 g/mol |
| IUPAC name | 1-(7-ethyl-1H-indol-3-yl)-2,2,2-trifluoroethanone |
| InChIKey | CFHSXKZWXJYSSI-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC=C1)C(=CN2)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)