CAS 75934-42-8 appears in our catalog under these names: 4,6-Dimethyl-1-trifluoroacetylindole, 95%, 1–(4,6–Dimethyl–1H–indol–1–yl)–2,2,2–trifluoroethanone. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
1-(4,6-dimethylindol-1-yl)-2,2,2-trifluoroethanone (CAS 75934-42-8) is a chemical compound with the molecular formula C12H10F3NO and a molecular weight of 241.21 g/mol. IUPAC name: 1-(4,6-dimethylindol-1-yl)-2,2,2-trifluoroethanone. InChIKey: GFBSFAXMGMRPBU-UHFFFAOYSA-N.
| Molecular formula | C12H10F3NO |
|---|---|
| Molecular weight | 241.21 g/mol |
| IUPAC name | 1-(4,6-dimethylindol-1-yl)-2,2,2-trifluoroethanone |
| InChIKey | GFBSFAXMGMRPBU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=CN(C2=C1)C(=O)C(F)(F)F)C |
Computed by PubChem (NCBI)