Products 2803902-63-6
CAS 2803902-63-6 is the registry number for 5-Hydroxy-1-(trifluoromethyl)-5,6,7,8-tetrahydronaphthalene-2-carbonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-hydroxy-1-(trifluoromethyl)-5,6,7,8-tetrahydronaphthalene-2-carbonitrile (CAS 2803902-63-6) is a chemical compound with the molecular formula C12H10F3NO and a molecular weight of 241.21 g/mol. IUPAC name: 5-hydroxy-1-(trifluoromethyl)-5,6,7,8-tetrahydronaphthalene-2-carbonitrile. InChIKey: JKCHGYNEPWSVIP-UHFFFAOYSA-N.
| Molecular formula | C12H10F3NO |
|---|---|
| Molecular weight | 241.21 g/mol |
| IUPAC name | 5-hydroxy-1-(trifluoromethyl)-5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
| InChIKey | JKCHGYNEPWSVIP-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C(=C(C=C2)C#N)C(F)(F)F)O |
Computed by PubChem (NCBI)