Products 2773478-13-8
CAS 2773478-13-8 is the registry number for Ethyl 5-(1-(methylsulfonyl)cyclopropyl)-1,3,4-oxadiazole-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-(1-methylsulfonylcyclopropyl)-1,3,4-oxadiazole-2-carboxylate (CAS 2773478-13-8) is a chemical compound with the molecular formula C9H12N2O5S and a molecular weight of 260.27 g/mol. IUPAC name: ethyl 5-(1-methylsulfonylcyclopropyl)-1,3,4-oxadiazole-2-carboxylate. InChIKey: GXIZPXOAXBRIOD-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O5S |
|---|---|
| Molecular weight | 260.27 g/mol |
| IUPAC name | ethyl 5-(1-methylsulfonylcyclopropyl)-1,3,4-oxadiazole-2-carboxylate |
| InChIKey | GXIZPXOAXBRIOD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN=C(O1)C2(CC2)S(=O)(=O)C |
Computed by PubChem (NCBI)