CAS 278614-91-8 is the registry number for 2,7-Dichloro-4H-pyrido(1,2-a)pyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2,7-dichloropyrido[1,2-a]pyrimidin-4-one (CAS 278614-91-8) is a chemical compound with the molecular formula C8H4Cl2N2O and a molecular weight of 215.03 g/mol. IUPAC name: 2,7-dichloropyrido[1,2-a]pyrimidin-4-one. InChIKey: NTUDDGZNPQEOQZ-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2O |
|---|---|
| Molecular weight | 215.03 g/mol |
| IUPAC name | 2,7-dichloropyrido[1,2-a]pyrimidin-4-one |
| InChIKey | NTUDDGZNPQEOQZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CC(=O)N2C=C1Cl)Cl |
Computed by PubChem (NCBI)