CAS 2791314-20-8 is the registry number for 6-Bromo-4-methoxythiazolo[4,5-c]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-4-methoxy-[1,3]thiazolo[4,5-c]pyridine (CAS 2791314-20-8) is a chemical compound with the molecular formula C7H5BrN2OS and a molecular weight of 245.10 g/mol. IUPAC name: 6-bromo-4-methoxy-[1,3]thiazolo[4,5-c]pyridine. InChIKey: FHFIWXFESRDNEW-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2OS |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 6-bromo-4-methoxy-[1,3]thiazolo[4,5-c]pyridine |
| InChIKey | FHFIWXFESRDNEW-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC(=N1)Br)SC=N2 |
Computed by PubChem (NCBI)