Products 2794948-99-3
CAS 2794948-99-3 is the registry number for rel-N-(((3R,4S)-4-Hydroxytetrahydrofuran-3-yl)methyl)-4-methylbenzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[[(3R,4S)-4-hydroxyoxolan-3-yl]methyl]-4-methylbenzenesulfonamide (CAS 2794948-99-3) is a chemical compound with the molecular formula C12H17NO4S and a molecular weight of 271.33 g/mol. IUPAC name: N-[[(3R,4S)-4-hydroxyoxolan-3-yl]methyl]-4-methylbenzenesulfonamide. InChIKey: FXIVAFLOOIMLEH-ZYHUDNBSSA-N.
| Molecular formula | C12H17NO4S |
|---|---|
| Molecular weight | 271.33 g/mol |
| IUPAC name | N-[[(3R,4S)-4-hydroxyoxolan-3-yl]methyl]-4-methylbenzenesulfonamide |
| InChIKey | FXIVAFLOOIMLEH-ZYHUDNBSSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC[C@@H]2COC[C@H]2O |
Computed by PubChem (NCBI)