Products 2805494-43-1

CAS 2805494-43-1 is the registry number for methyl trans-4-methylpyrrolidine-2-carboxylate,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

Methyl (2R,4S)-4-methylpyrrolidine-2-carboxylate;hydrochloride (CAS 2805494-43-1) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: methyl (2R,4S)-4-methylpyrrolidine-2-carboxylate;hydrochloride. InChIKey: WOOLOOYCBNNORY-RIHPBJNCSA-N.

Identity
Molecular formulaC7H14ClNO2
Molecular weight179.64 g/mol
IUPAC namemethyl (2R,4S)-4-methylpyrrolidine-2-carboxylate;hydrochloride
InChIKeyWOOLOOYCBNNORY-RIHPBJNCSA-N
SMILESC[C@H]1C[C@@H](NC1)C(=O)OC.Cl

Computed by PubChem (NCBI)