CAS 2940866-91-9 is the registry number for methyl (2S,4R)-4-methylpyrrolidine-2-carboxylate hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Methyl (2S,4R)-4-methylpyrrolidine-2-carboxylate;hydrochloride (CAS 2940866-91-9) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: methyl (2S,4R)-4-methylpyrrolidine-2-carboxylate;hydrochloride. InChIKey: WOOLOOYCBNNORY-IBTYICNHSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | methyl (2S,4R)-4-methylpyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | WOOLOOYCBNNORY-IBTYICNHSA-N |
| SMILES | C[C@@H]1C[C@H](NC1)C(=O)OC.Cl |
Computed by PubChem (NCBI)