CAS 280566-45-2 appears in our catalog under these names: 2-Chloro-6-trifluoromethylnicotinic acid, 98%, 2–Chloro–6–(trifluoromethyl)pyridine–3–carboxylic acid, 2-Chloro-6-(trifluoromethyl)nicotinic Acid, >98.0%(T). Offered by: Fluorochem, GLPBio, TCI. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
2-chloro-6-(trifluoromethyl)pyridine-3-carboxylic acid (CAS 280566-45-2) is a chemical compound with the molecular formula C7H3ClF3NO2 and a molecular weight of 225.55 g/mol. IUPAC name: 2-chloro-6-(trifluoromethyl)pyridine-3-carboxylic acid. InChIKey: DXRBTBMFFGEVCX-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO2 |
|---|---|
| Molecular weight | 225.55 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | DXRBTBMFFGEVCX-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)