CAS 28077-41-0 appears in our catalog under these names: 3-(2-Methyl-1,3-thiazol-4-yl)benzoic acid, 98%, 3-(2-Methylthiazol-4-yl)benzoic acid, 98%, 3-(2-Methyl-1,3-thiazol-4-yl)benzoic acid, 3-(2-Methyl-1,3-thiazol-4-yl)benzoic acid, 97% , 3-(2-Methylthiazol-4-yl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Thermo Scientific, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 2g, 10g.
3-(2-methyl-1,3-thiazol-4-yl)benzoic acid (CAS 28077-41-0) is a chemical compound with the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. IUPAC name: 3-(2-methyl-1,3-thiazol-4-yl)benzoic acid. InChIKey: YDPHSMPSNLAMJE-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 3-(2-methyl-1,3-thiazol-4-yl)benzoic acid |
| InChIKey | YDPHSMPSNLAMJE-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)