Products 28096-56-2
CAS 28096-56-2 is the registry number for 4-(Dimethylamino)-3-nitrobenzoic Acid. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 0,05g, 0,1g, 0,25g, 0,5g, 1g.
4-(dimethylamino)-3-nitrobenzoic acid (CAS 28096-56-2) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: 4-(dimethylamino)-3-nitrobenzoic acid. InChIKey: ZXBMWJZLUDXEPS-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | 4-(dimethylamino)-3-nitrobenzoic acid |
| InChIKey | ZXBMWJZLUDXEPS-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
4-(dimethylamino)-3-nitrobenzoic acid, ZXBMWJZLUDXEPS-UHFFFAOYSA-N, 4-dimethylamino-3-nitro-benzoic Acid, 4-(dimethylamino)-3-nitro-benzoic acid, 4-(Dimethylamino)-3-nitrobenzoicacid, 4-(N,N-dimethylamino)-3-nitrobenzoic acid, 4-(dimethylamino)-3-nitrobenzoic acid? (Dabigatran Impurity pound(c)