Products 28123-63-9

CAS 28123-63-9 appears in our catalog under these names: 4-Chloro-N-hydroxybenzenecarboximidoyl chloride, 95%, 4-Chloro-N-hydroxybenzimidoyl chloride, >=95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

(1Z)-4-chloro-N-hydroxybenzenecarboximidoyl chloride (CAS 28123-63-9) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 190.02 g/mol. IUPAC name: (1Z)-4-chloro-N-hydroxybenzenecarboximidoyl chloride. InChIKey: JPBNMRDGFBFKLT-YFHOEESVSA-N.

Identity
Molecular formulaC7H5Cl2NO
Molecular weight190.02 g/mol
IUPAC name(1Z)-4-chloro-N-hydroxybenzenecarboximidoyl chloride
InChIKeyJPBNMRDGFBFKLT-YFHOEESVSA-N
SMILESC1=CC(=CC=C1/C(=N/O)/Cl)Cl

Computed by PubChem (NCBI)