CAS 2815-67-0 is the registry number for 1,2-Dimethoxy-3-(2-nitrovinyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
1,2-dimethoxy-3-[(E)-2-nitroethenyl]benzene (CAS 2815-67-0) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 1,2-dimethoxy-3-[(E)-2-nitroethenyl]benzene. InChIKey: OFJZSDMKKDTNHZ-VOTSOKGWSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 1,2-dimethoxy-3-[(E)-2-nitroethenyl]benzene |
| InChIKey | OFJZSDMKKDTNHZ-VOTSOKGWSA-N |
| SMILES | COC1=CC=CC(=C1OC)/C=C/[N+](=O)[O-] |
Computed by PubChem (NCBI)