CAS 37630-20-9 appears in our catalog under these names: Dopamine Impurity 6, (E)-1,2-Dimethoxy-3-(2-nitrovinyl)benzene, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-dimethoxy-3-[(E)-2-nitroethenyl]benzene (CAS 37630-20-9) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 1,2-dimethoxy-3-[(E)-2-nitroethenyl]benzene. InChIKey: OFJZSDMKKDTNHZ-VOTSOKGWSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 1,2-dimethoxy-3-[(E)-2-nitroethenyl]benzene |
| InChIKey | OFJZSDMKKDTNHZ-VOTSOKGWSA-N |
| SMILES | COC1=CC=CC(=C1OC)/C=C/[N+](=O)[O-] |
Computed by PubChem (NCBI)