CAS 28179-47-7 appears in our catalog under these names: 5-Aminoisophthalic acid monomethyl ester, 95%, 3-Amino-5-(methoxycarbonyl)benzoic acid 97%, 3-Amino-5-(methoxycarbonyl)benzoic acid, 97%, 97%, 3-Amino-5-(methoxycarbonyl)benzoic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 250mg, 10g.
3-amino-5-methoxycarbonylbenzoic acid (CAS 28179-47-7) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 3-amino-5-methoxycarbonylbenzoic acid. InChIKey: QGGKQIDRZUUHAR-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 3-amino-5-methoxycarbonylbenzoic acid |
| InChIKey | QGGKQIDRZUUHAR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C(=O)O)N |
Computed by PubChem (NCBI)