Products 28197-46-8
CAS 28197-46-8 appears in our catalog under these names: Acebutolol Impurity 13, Acebutolol impurity 1. Offered by: Hubei YoungXin, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, Get quote.
N-(3-acetyl-4-hydroxyphenyl)propanamide (CAS 28197-46-8) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: N-(3-acetyl-4-hydroxyphenyl)propanamide. InChIKey: XBQQVFQWRVJOPM-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | N-(3-acetyl-4-hydroxyphenyl)propanamide |
| InChIKey | XBQQVFQWRVJOPM-UHFFFAOYSA-N |
| SMILES | CCC(=O)NC1=CC(=C(C=C1)O)C(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Acebutolol Impurity 2