Products 2820500-86-3
CAS 2820500-86-3 is the registry number for 3-(4-bromo-1H-indazol-1-yl)piperidine-2,6-dione, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
3-(4-bromoindazol-1-yl)piperidine-2,6-dione (CAS 2820500-86-3) is a chemical compound with the molecular formula C12H10BrN3O2 and a molecular weight of 308.13 g/mol. IUPAC name: 3-(4-bromoindazol-1-yl)piperidine-2,6-dione. InChIKey: DITMZYRFPRDCID-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN3O2 |
|---|---|
| Molecular weight | 308.13 g/mol |
| IUPAC name | 3-(4-bromoindazol-1-yl)piperidine-2,6-dione |
| InChIKey | DITMZYRFPRDCID-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C3=C(C=N2)C(=CC=C3)Br |
Computed by PubChem (NCBI)