CAS 2824-57-9 appears in our catalog under these names: Ac–Trp–OMe, Ac-L-Trp-OMe, N-Acetyl-L-tryptophan methyl ester, 95% , Methyl N-Acetyl-L-tryptophanate, >98.0%(HPLC), Methyl N-acetyl-L-tryptophanate, 98%, 98%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI, Chemat. Available pack sizes: 25g, 5g, 100g, 1g, 10g.
Methyl (2S)-2-acetamido-3-(1H-indol-3-yl)propanoate (CAS 2824-57-9) is a chemical compound with the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. IUPAC name: methyl (2S)-2-acetamido-3-(1H-indol-3-yl)propanoate. InChIKey: XZECNVJPYDPBAM-ZDUSSCGKSA-N.
| Molecular formula | C14H16N2O3 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | methyl (2S)-2-acetamido-3-(1H-indol-3-yl)propanoate |
| InChIKey | XZECNVJPYDPBAM-ZDUSSCGKSA-N |
| SMILES | CC(=O)N[C@@H](CC1=CNC2=CC=CC=C21)C(=O)OC |
Computed by PubChem (NCBI)