Products 2835511-03-8
CAS 2835511-03-8 is the registry number for GRL-1720, 98.87%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 50 mg, 5 mg, 10mM/1mL, 100 mg, 25 mg.
(5-chloro-3-pyridinyl) 2,3-dihydro-1H-indole-4-carboxylate (CAS 2835511-03-8) is a chemical compound with the molecular formula C14H11ClN2O2 and a molecular weight of 274.70 g/mol. IUPAC name: (5-chloro-3-pyridinyl) 2,3-dihydro-1H-indole-4-carboxylate. InChIKey: JROSKNTUYSPHGX-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2O2 |
|---|---|
| Molecular weight | 274.70 g/mol |
| IUPAC name | (5-chloro-3-pyridinyl) 2,3-dihydro-1H-indole-4-carboxylate |
| InChIKey | JROSKNTUYSPHGX-UHFFFAOYSA-N |
| SMILES | C1CNC2=CC=CC(=C21)C(=O)OC3=CC(=CN=C3)Cl |
Computed by PubChem (NCBI)