Products 2839320-62-4
CAS 2839320-62-4 is the registry number for 4,6-Dichloro-α-(1-methylethyl)-3-pyridinemethanol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(4,6-dichloro-3-pyridinyl)-2-methylpropan-1-ol (CAS 2839320-62-4) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: 1-(4,6-dichloro-3-pyridinyl)-2-methylpropan-1-ol. InChIKey: VNVWBEBRDHRPDL-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | 1-(4,6-dichloro-3-pyridinyl)-2-methylpropan-1-ol |
| InChIKey | VNVWBEBRDHRPDL-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=CN=C(C=C1Cl)Cl)O |
Computed by PubChem (NCBI)