Products 2840-37-1

CAS 2840-37-1 is the registry number for 1-(2-Ethoxycarbonyl-ethyl)-piperidine-2-carboxylic acid ethyl ester, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 1-(3-ethoxy-3-oxopropyl)piperidine-2-carboxylate (CAS 2840-37-1) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: ethyl 1-(3-ethoxy-3-oxopropyl)piperidine-2-carboxylate. InChIKey: SNRCNAJPIJLHSH-UHFFFAOYSA-N.

Identity
Molecular formulaC13H23NO4
Molecular weight257.33 g/mol
IUPAC nameethyl 1-(3-ethoxy-3-oxopropyl)piperidine-2-carboxylate
InChIKeySNRCNAJPIJLHSH-UHFFFAOYSA-N
SMILESCCOC(=O)CCN1CCCCC1C(=O)OCC

Computed by PubChem (NCBI)