CAS 2848722-14-3 is the registry number for (S)-2-(4-(2,2-Difluorocyclopropyl)phenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-[(1S)-2,2-difluorocyclopropyl]phenyl]acetic acid (CAS 2848722-14-3) is a chemical compound with the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. IUPAC name: 2-[4-[(1S)-2,2-difluorocyclopropyl]phenyl]acetic acid. InChIKey: LJZSNQLKVKRZMJ-VIFPVBQESA-N.
| Molecular formula | C11H10F2O2 |
|---|---|
| Molecular weight | 212.19 g/mol |
| IUPAC name | 2-[4-[(1S)-2,2-difluorocyclopropyl]phenyl]acetic acid |
| InChIKey | LJZSNQLKVKRZMJ-VIFPVBQESA-N |
| SMILES | C1[C@H](C1(F)F)C2=CC=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)